C15H12ClNO4 — CID 99942157
(2R,3S,4S)-6-chloro-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 99942157) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is (2R,3S,4S)-6-chloro-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (2R,3S,4S)-6-chloro-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 99942157 |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (2R,3S,4S)-6-chloro-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O=[N+]([O-])[C@@H]1[C@@H](c2ccccc2)Oc2ccc(Cl)cc2[C@@H]1O |
| InChI | InChI=1S/C15H12ClNO4/c16-10-6-7-12-11(8-10)14(18)13(17(19)20)15(21-12)9-4-2-1-3-5-9/h1-8,13-15,18H/t13-,14-,15+/m0/s1 |
| InChIKey | QPNVLFYMEAMXSZ-SOUVJXGZSA-N |
| XLogP | 3.15 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|