C22H19NO4 — CID 15427639
(2S,3S,4S)-3-[(4-nitrophenyl)methyl]-2-phenyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 15427639) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2S,3S,4S)-3-[(4-nitrophenyl)methyl]-2-phenyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (2S,3S,4S)-3-[(4-nitrophenyl)methyl]-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 15427639 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2S,3S,4S)-3-[(4-nitrophenyl)methyl]-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O=[N+]([O-])c1ccc(C[C@H]2[C@H](O)c3ccccc3O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO4/c24-21-18-8-4-5-9-20(18)27-22(16-6-2-1-3-7-16)19(21)14-15-10-12-17(13-11-15)23(25)26/h1-13,19,21-22,24H,14H2/t19-,21+,22+/m0/s1 |
| InChIKey | CXXWUHXHZDIBKE-KSEOMHKRSA-N |
| XLogP | 4.62 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|