C21H17NO4 — CID 71407648
(2R,4R)-4-(4-nitrophenoxy)-2-phenyl-3,4-dihydro-2H-chromene (PubChem CID 71407648) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (2R,4R)-4-(4-nitrophenoxy)-2-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | (2R,4R)-4-(4-nitrophenoxy)-2-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 71407648 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (2R,4R)-4-(4-nitrophenoxy)-2-phenyl-3,4-dihydro-2H-chromene |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2C[C@H](c3ccccc3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C21H17NO4/c23-22(24)16-10-12-17(13-11-16)25-21-14-20(15-6-2-1-3-7-15)26-19-9-5-4-8-18(19)21/h1-13,20-21H,14H2/t20-,21-/m1/s1 |
| InChIKey | DMNFBMODOFLZMW-NHCUHLMSSA-N |
| XLogP | 5.24 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|