C24H18N2O3 — CID 101117497
(2S,4R)-4-(4-nitrophenyl)-2,6-diphenyl-3,4-dihydro-2H-pyran-5-carbonitrile (PubChem CID 101117497) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is (2S,4R)-4-(4-nitrophenyl)-2,6-diphenyl-3,4-dihydro-2H-pyran-5-carbonitrile.
| Compound Name | (2S,4R)-4-(4-nitrophenyl)-2,6-diphenyl-3,4-dihydro-2H-pyran-5-carbonitrile |
|---|---|
| PubChem CID | 101117497 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (2S,4R)-4-(4-nitrophenyl)-2,6-diphenyl-3,4-dihydro-2H-pyran-5-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)O[C@H](c2ccccc2)C[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18N2O3/c25-16-22-21(17-11-13-20(14-12-17)26(27)28)15-23(18-7-3-1-4-8-18)29-24(22)19-9-5-2-6-10-19/h1-14,21,23H,15H2/t21-,23+/m1/s1 |
| InChIKey | WLMUTHWRRPVORP-GGAORHGYSA-N |
| XLogP | 5.77 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|