C22H17NO3 — CID 10665069
(15R)-15-(4-nitrophenoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 10665069) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is (15R)-15-(4-nitrophenoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | (15R)-15-(4-nitrophenoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 10665069 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (15R)-15-(4-nitrophenoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2CC3c4ccccc4C2c2ccccc23)cc1 |
| InChI | InChI=1S/C22H17NO3/c24-23(25)14-9-11-15(12-10-14)26-21-13-20-16-5-1-3-7-18(16)22(21)19-8-4-2-6-17(19)20/h1-12,20-22H,13H2/t20?,21-,22?/m1/s1 |
| InChIKey | VIMYNRRUHNUQKW-ATKRNPRHSA-N |
| XLogP | 5.02 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|