C15H11NO5 — CID 155544931
(2S,3S)-3-hydroxy-2-(4-nitrophenyl)-2,3-dihydrochromen-4-one (PubChem CID 155544931) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-(4-nitrophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3S)-3-hydroxy-2-(4-nitrophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 155544931 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-(4-nitrophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2ccccc2O[C@@H](c2ccc([N+](=O)[O-])cc2)[C@@H]1O |
| InChI | InChI=1S/C15H11NO5/c17-13-11-3-1-2-4-12(11)21-15(14(13)18)9-5-7-10(8-6-9)16(19)20/h1-8,14-15,18H/t14-,15+/m1/s1 |
| InChIKey | NQOMGSISIIUPMW-CABCVRRESA-N |
| XLogP | 2.27 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|