C21H14ClNO7S — CID 10456932
[(2R,3R)-2-(4-chlorophenyl)-4-oxo-2,3-dihydrochromen-3-yl] 4-nitrobenzenesulfonate (PubChem CID 10456932) has the molecular formula C21H14ClNO7S and a molecular weight of 459.86 g/mol. Its IUPAC name is [(2R,3R)-2-(4-chlorophenyl)-4-oxo-2,3-dihydrochromen-3-yl] 4-nitrobenzenesulfonate.
| Compound Name | [(2R,3R)-2-(4-chlorophenyl)-4-oxo-2,3-dihydrochromen-3-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 10456932 |
| Molecular Formula | C21H14ClNO7S |
| Molecular Weight | 459.86 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | [(2R,3R)-2-(4-chlorophenyl)-4-oxo-2,3-dihydrochromen-3-yl] 4-nitrobenzenesulfonate |
| SMILES | O=C1c2ccccc2O[C@H](c2ccc(Cl)cc2)[C@H]1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14ClNO7S/c22-14-7-5-13(6-8-14)20-21(19(24)17-3-1-2-4-18(17)29-20)30-31(27,28)16-11-9-15(10-12-16)23(25)26/h1-12,20-21H/t20-,21+/m1/s1 |
| InChIKey | IYPQCDJFWYDISL-RTWAWAEBSA-N |
| XLogP | 4.34 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|