C14H9NO4S — CID 703671
(2S)-2-(4-nitrophenyl)-3,1-benzoxathiin-4-one (PubChem CID 703671) has the molecular formula C14H9NO4S and a molecular weight of 287.30 g/mol. Its IUPAC name is (2S)-2-(4-nitrophenyl)-3,1-benzoxathiin-4-one.
| Compound Name | (2S)-2-(4-nitrophenyl)-3,1-benzoxathiin-4-one |
|---|---|
| PubChem CID | 703671 |
| Molecular Formula | C14H9NO4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | (2S)-2-(4-nitrophenyl)-3,1-benzoxathiin-4-one |
| SMILES | O=C1O[C@H](c2ccc([N+](=O)[O-])cc2)Sc2ccccc21 |
| InChI | InChI=1S/C14H9NO4S/c16-13-11-3-1-2-4-12(11)20-14(19-13)9-5-7-10(8-6-9)15(17)18/h1-8,14H/t14-/m0/s1 |
| InChIKey | JGPYSTGKMNQEJQ-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|