C22H14N2O2S2 — CID 7317126
(11R)-11-(4-nitrophenyl)-5,11-dihydroindeno[2,1-c][1,5]benzothiazepine-12-thione (PubChem CID 7317126) has the molecular formula C22H14N2O2S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (11R)-11-(4-nitrophenyl)-5,11-dihydroindeno[2,1-c][1,5]benzothiazepine-12-thione.
| Compound Name | (11R)-11-(4-nitrophenyl)-5,11-dihydroindeno[2,1-c][1,5]benzothiazepine-12-thione |
|---|---|
| PubChem CID | 7317126 |
| Molecular Formula | C22H14N2O2S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (11R)-11-(4-nitrophenyl)-5,11-dihydroindeno[2,1-c][1,5]benzothiazepine-12-thione |
| SMILES | O=[N+]([O-])c1ccc([C@H]2Sc3ccccc3NC3=C2C(=S)c2ccccc23)cc1 |
| InChI | InChI=1S/C22H14N2O2S2/c25-24(26)14-11-9-13(10-12-14)22-19-20(15-5-1-2-6-16(15)21(19)27)23-17-7-3-4-8-18(17)28-22/h1-12,22-23H/t22-/m1/s1 |
| InChIKey | QYSPMKGKUFZYSW-JOCHJYFZSA-N |
| XLogP | 6.00 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|