C8H6N2O3S — CID 141103329
2-nitro-4H-1,4-benzothiazin-3-one (PubChem CID 141103329) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-nitro-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-nitro-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 141103329 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-nitro-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2SC1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6N2O3S/c11-7-8(10(12)13)14-6-4-2-1-3-5(6)9-7/h1-4,8H,(H,9,11) |
| InChIKey | KWJCZXXHNBQLOW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|