C13H13NO2S — CID 2443133
(2R)-2-[(1R)-2-oxocyclopentyl]-4H-1,4-benzothiazin-3-one (PubChem CID 2443133) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is (2R)-2-[(1R)-2-oxocyclopentyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2R)-2-[(1R)-2-oxocyclopentyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 2443133 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (2R)-2-[(1R)-2-oxocyclopentyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CCC[C@H]1[C@H]1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C13H13NO2S/c15-10-6-3-4-8(10)12-13(16)14-9-5-1-2-7-11(9)17-12/h1-2,5,7-8,12H,3-4,6H2,(H,14,16)/t8-,12-/m1/s1 |
| InChIKey | WBQGEUHQTIXKKI-PRHODGIISA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |