C8H8NO4PS — CID 174507583
(3-oxo-4H-1,4-benzothiazin-2-yl)phosphonic acid (PubChem CID 174507583) has the molecular formula C8H8NO4PS and a molecular weight of 245.20 g/mol. Its IUPAC name is (3-oxo-4H-1,4-benzothiazin-2-yl)phosphonic acid.
| Compound Name | (3-oxo-4H-1,4-benzothiazin-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 174507583 |
| Molecular Formula | C8H8NO4PS |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | (3-oxo-4H-1,4-benzothiazin-2-yl)phosphonic acid |
| SMILES | O=C1Nc2ccccc2SC1P(=O)(O)O |
| InChI | InChI=1S/C8H8NO4PS/c10-7-8(14(11,12)13)15-6-4-2-1-3-5(6)9-7/h1-4,8H,(H,9,10)(H2,11,12,13) |
| InChIKey | NSBSZQBLNCQYRX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|