C12H11NOS — CID 4159710
2,3,4a,10-tetrahydrophenothiazin-4-one (PubChem CID 4159710) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is 2,3,4a,10-tetrahydrophenothiazin-4-one.
| Compound Name | 2,3,4a,10-tetrahydrophenothiazin-4-one |
|---|---|
| PubChem CID | 4159710 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2,3,4a,10-tetrahydrophenothiazin-4-one |
| SMILES | O=C1CCC=C2Nc3ccccc3SC12 |
| InChI | InChI=1S/C12H11NOS/c14-10-6-3-5-9-12(10)15-11-7-2-1-4-8(11)13-9/h1-2,4-5,7,12-13H,3,6H2 |
| InChIKey | MPZDAGWRNHNBRC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |