C15H12BrNOS — CID 901854
(2R)-2-(2-bromophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 901854) has the molecular formula C15H12BrNOS and a molecular weight of 334.24 g/mol. Its IUPAC name is (2R)-2-(2-bromophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
| Compound Name | (2R)-2-(2-bromophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 901854 |
| Molecular Formula | C15H12BrNOS |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | (2R)-2-(2-bromophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | O=C1C[C@H](c2ccccc2Br)Sc2ccccc2N1 |
| InChI | InChI=1S/C15H12BrNOS/c16-11-6-2-1-5-10(11)14-9-15(18)17-12-7-3-4-8-13(12)19-14/h1-8,14H,9H2,(H,17,18)/t14-/m1/s1 |
| InChIKey | BQMQTZXFGICBGL-CQSZACIVSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |