C15H13NOS — CID 738643
(2S)-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 738643) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is (2S)-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
| Compound Name | (2S)-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 738643 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (2S)-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | O=C1C[C@@H](c2ccccc2)Sc2ccccc2N1 |
| InChI | InChI=1S/C15H13NOS/c17-15-10-14(11-6-2-1-3-7-11)18-13-9-5-4-8-12(13)16-15/h1-9,14H,10H2,(H,16,17)/t14-/m0/s1 |
| InChIKey | XIJZRXDBTDOULF-AWEZNQCLSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |