C24H18ClNO2S — CID 102384442
(3Z)-3-[2-(4-chlorophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene]-4H-chromen-2-one (PubChem CID 102384442) has the molecular formula C24H18ClNO2S and a molecular weight of 419.93 g/mol. Its IUPAC name is (3Z)-3-[2-(4-chlorophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene]-4H-chromen-2-one.
| Compound Name | (3Z)-3-[2-(4-chlorophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene]-4H-chromen-2-one |
|---|---|
| PubChem CID | 102384442 |
| Molecular Formula | C24H18ClNO2S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (3Z)-3-[2-(4-chlorophenyl)-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene]-4H-chromen-2-one |
| SMILES | O=C1Oc2ccccc2C/C1=C1\CC(c2ccc(Cl)cc2)Sc2ccccc2N1 |
| InChI | InChI=1S/C24H18ClNO2S/c25-17-11-9-15(10-12-17)23-14-20(26-19-6-2-4-8-22(19)29-23)18-13-16-5-1-3-7-21(16)28-24(18)27/h1-12,23,26H,13-14H2/b20-18- |
| InChIKey | CKKNAUNUVPPSHI-ZZEZOPTASA-N |
| XLogP | 6.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|