C10H10N2OS — CID 171370249
2-imino-6-phenyl-1,3-thiazinan-4-one (PubChem CID 171370249) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-imino-6-phenyl-1,3-thiazinan-4-one.
| Compound Name | 2-imino-6-phenyl-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 171370249 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-imino-6-phenyl-1,3-thiazinan-4-one |
| SMILES | [H]/N=C1/NC(=O)CC(c2ccccc2)S1 |
| InChI | InChI=1S/C10H10N2OS/c11-10-12-9(13)6-8(14-10)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,11,12,13) |
| InChIKey | XUNWWYMPVATWGZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|