C11H11NOS2 — CID 14142764
3-methyl-6-phenyl-2-sulfanylidene-1,3-thiazinan-4-one (PubChem CID 14142764) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-methyl-6-phenyl-2-sulfanylidene-1,3-thiazinan-4-one.
| Compound Name | 3-methyl-6-phenyl-2-sulfanylidene-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 14142764 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 3-methyl-6-phenyl-2-sulfanylidene-1,3-thiazinan-4-one |
| SMILES | CN1C(=O)CC(c2ccccc2)SC1=S |
| InChI | InChI=1S/C11H11NOS2/c1-12-10(13)7-9(15-11(12)14)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3 |
| InChIKey | JUIPHBNGVMYMNP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|