C11H10OS2 — CID 136721068
(2S)-4-hydroxy-2-phenyl-2,3-dihydrothiopyran-6-thione (PubChem CID 136721068) has the molecular formula C11H10OS2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-phenyl-2,3-dihydrothiopyran-6-thione.
| Compound Name | (2S)-4-hydroxy-2-phenyl-2,3-dihydrothiopyran-6-thione |
|---|---|
| PubChem CID | 136721068 |
| Molecular Formula | C11H10OS2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | (2S)-4-hydroxy-2-phenyl-2,3-dihydrothiopyran-6-thione |
| SMILES | OC1=CC(=S)S[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C11H10OS2/c12-9-6-10(14-11(13)7-9)8-4-2-1-3-5-8/h1-5,7,10,12H,6H2/t10-/m0/s1 |
| InChIKey | YZLAUJHBSUZAHS-JTQLQIEISA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|