C16H15NS — CID 11391140
4-methyl-2-phenyl-2,3-dihydro-1,5-benzothiazepine (PubChem CID 11391140) has the molecular formula C16H15NS and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-methyl-2-phenyl-2,3-dihydro-1,5-benzothiazepine.
| Compound Name | 4-methyl-2-phenyl-2,3-dihydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 11391140 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-methyl-2-phenyl-2,3-dihydro-1,5-benzothiazepine |
| SMILES | CC1=Nc2ccccc2SC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15NS/c1-12-11-16(13-7-3-2-4-8-13)18-15-10-6-5-9-14(15)17-12/h2-10,16H,11H2,1H3 |
| InChIKey | RGNOVJJNIDKLMO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |