About 6-phenylthiane-2-thione
6-phenylthiane-2-thione (PubChem CID 100945824) has the molecular formula C11H12S2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 6-phenylthiane-2-thione.
Molecular Properties
| Compound Name | 6-phenylthiane-2-thione |
| PubChem CID | 100945824 |
| Molecular Formula | C11H12S2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 6-phenylthiane-2-thione |
| SMILES | S=C1CCCC(c2ccccc2)S1 |
| InChI | InChI=1S/C11H12S2/c12-11-8-4-7-10(13-11)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | GCCLLKIOFRZSRN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-phenylthiane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylthiane-2-thione?
The IUPAC name of 6-phenylthiane-2-thione (CID 100945824) is 6-phenylthiane-2-thione.
What is the SMILES notation for 6-phenylthiane-2-thione?
The canonical SMILES for 6-phenylthiane-2-thione is S=C1CCCC(c2ccccc2)S1.
What is the InChIKey of 6-phenylthiane-2-thione?
The InChIKey is GCCLLKIOFRZSRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12S2/c12-11-8-4-7-10(13-11)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2.
What are the key properties of 6-phenylthiane-2-thione?
6-phenylthiane-2-thione has a molecular weight of 208.35 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylthiane-2-thione is sourced from PubChem (CID 100945824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).