C22H22 — CID 14691568
6,7-diphenyl-1,2,3,4,6,7-hexahydronaphthalene (PubChem CID 14691568) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is 6,7-diphenyl-1,2,3,4,6,7-hexahydronaphthalene.
| Compound Name | 6,7-diphenyl-1,2,3,4,6,7-hexahydronaphthalene |
|---|---|
| PubChem CID | 14691568 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6,7-diphenyl-1,2,3,4,6,7-hexahydronaphthalene |
| SMILES | C1=C2CCCCC2=CC(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C22H22/c1-3-9-17(10-4-1)21-15-19-13-7-8-14-20(19)16-22(21)18-11-5-2-6-12-18/h1-6,9-12,15-16,21-22H,7-8,13-14H2 |
| InChIKey | BHJFGGOFIFKIJI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |