C17H20O — CID 24975573
1-phenyl-1,2,4,5,6,7,8,9-octahydrocyclopenta[8]annulen-3-one (PubChem CID 24975573) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-phenyl-1,2,4,5,6,7,8,9-octahydrocyclopenta[8]annulen-3-one.
| Compound Name | 1-phenyl-1,2,4,5,6,7,8,9-octahydrocyclopenta[8]annulen-3-one |
|---|---|
| PubChem CID | 24975573 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-phenyl-1,2,4,5,6,7,8,9-octahydrocyclopenta[8]annulen-3-one |
| SMILES | O=C1CC(c2ccccc2)C2=C1CCCCCC2 |
| InChI | InChI=1S/C17H20O/c18-17-12-16(13-8-4-3-5-9-13)14-10-6-1-2-7-11-15(14)17/h3-5,8-9,16H,1-2,6-7,10-12H2 |
| InChIKey | MQRYOISKAYHLMJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |