C15H18O2S — CID 12516434
4-phenyl-3,4,5,6,7,8-hexahydro-1H-isothiochromene 2,2-dioxide (PubChem CID 12516434) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-phenyl-3,4,5,6,7,8-hexahydro-1H-isothiochromene 2,2-dioxide.
| Compound Name | 4-phenyl-3,4,5,6,7,8-hexahydro-1H-isothiochromene 2,2-dioxide |
|---|---|
| PubChem CID | 12516434 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-phenyl-3,4,5,6,7,8-hexahydro-1H-isothiochromene 2,2-dioxide |
| SMILES | O=S1(=O)CC2=C(CCCC2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C15H18O2S/c16-18(17)10-13-8-4-5-9-14(13)15(11-18)12-6-2-1-3-7-12/h1-3,6-7,15H,4-5,8-11H2 |
| InChIKey | PLISRTITNCBPHU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|