C17H22O3 — CID 13462752
6-(1,3-dioxolan-2-yl)-2-phenylcyclooctan-1-one (PubChem CID 13462752) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 6-(1,3-dioxolan-2-yl)-2-phenylcyclooctan-1-one.
| Compound Name | 6-(1,3-dioxolan-2-yl)-2-phenylcyclooctan-1-one |
|---|---|
| PubChem CID | 13462752 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 6-(1,3-dioxolan-2-yl)-2-phenylcyclooctan-1-one |
| SMILES | O=C1CCC(C2OCCO2)CCCC1c1ccccc1 |
| InChI | InChI=1S/C17H22O3/c18-16-10-9-14(17-19-11-12-20-17)7-4-8-15(16)13-5-2-1-3-6-13/h1-3,5-6,14-15,17H,4,7-12H2 |
| InChIKey | VGTKSMQXFPFCGO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |