C10H8O3 — CID 129383036
(4S)-4-phenyloxolane-2,3-dione (PubChem CID 129383036) has the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. Its IUPAC name is (4S)-4-phenyloxolane-2,3-dione.
| Compound Name | (4S)-4-phenyloxolane-2,3-dione |
|---|---|
| PubChem CID | 129383036 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | (4S)-4-phenyloxolane-2,3-dione |
| SMILES | O=C1OC[C@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C10H8O3/c11-9-8(6-13-10(9)12)7-4-2-1-3-5-7/h1-5,8H,6H2/t8-/m1/s1 |
| InChIKey | WYGILTLZANOLBZ-MRVPVSSYSA-N |
| XLogP | 0.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|