C11H10O3 — CID 6339971
(3Z,4S)-3-(hydroxymethylidene)-4-phenyloxolan-2-one (PubChem CID 6339971) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is (3Z,4S)-3-(hydroxymethylidene)-4-phenyloxolan-2-one.
| Compound Name | (3Z,4S)-3-(hydroxymethylidene)-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 6339971 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (3Z,4S)-3-(hydroxymethylidene)-4-phenyloxolan-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)/C1=C/O |
| InChI | InChI=1S/C11H10O3/c12-6-9-10(7-14-11(9)13)8-4-2-1-3-5-8/h1-6,10,12H,7H2/b9-6-/t10-/m0/s1 |
| InChIKey | OESUMQMCVLDSHF-MBACFSSFSA-N |
| XLogP | 1.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|