C15H12O4 — CID 163076287
8-hydroxy-4-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one (PubChem CID 163076287) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 8-hydroxy-4-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one.
| Compound Name | 8-hydroxy-4-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 163076287 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 8-hydroxy-4-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OCC(c2ccc(O)cc2)c2cccc(O)c21 |
| InChI | InChI=1S/C15H12O4/c16-10-6-4-9(5-7-10)12-8-19-15(18)14-11(12)2-1-3-13(14)17/h1-7,12,16-17H,8H2 |
| InChIKey | NYJJDXBMMCNAFN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |