C16H14O4 — CID 139082569
(3R)-3-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one (PubChem CID 139082569) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3R)-3-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one.
| Compound Name | (3R)-3-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 139082569 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3R)-3-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc2c(c1)OC[C@@H](c1ccc(O)cc1)C2=O |
| InChI | InChI=1S/C16H14O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-8,14,17H,9H2,1H3/t14-/m0/s1 |
| InChIKey | YVVQDVPHBJABPW-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |