C24H30BrNO4 — CID 175142288
3-(4-hydroxyphenyl)-7-(4-piperidin-1-ylbutoxy)-2,3-dihydrochromen-4-one;hydrobromide (PubChem CID 175142288) has the molecular formula C24H30BrNO4 and a molecular weight of 476.41 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-7-(4-piperidin-1-ylbutoxy)-2,3-dihydrochromen-4-one;hydrobromide.
| Compound Name | 3-(4-hydroxyphenyl)-7-(4-piperidin-1-ylbutoxy)-2,3-dihydrochromen-4-one;hydrobromide |
|---|---|
| PubChem CID | 175142288 |
| Molecular Formula | C24H30BrNO4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-(4-hydroxyphenyl)-7-(4-piperidin-1-ylbutoxy)-2,3-dihydrochromen-4-one;hydrobromide |
| SMILES | Br.O=C1c2ccc(OCCCCN3CCCCC3)cc2OCC1c1ccc(O)cc1 |
| InChI | InChI=1S/C24H29NO4.BrH/c26-19-8-6-18(7-9-19)22-17-29-23-16-20(10-11-21(23)24(22)27)28-15-5-4-14-25-12-2-1-3-13-25;/h6-11,16,22,26H,1-5,12-15,17H2;1H |
| InChIKey | OYKNGBOJUCIENQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|