C16H21NO3 — CID 141317761
7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydrochromen-4-one (PubChem CID 141317761) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydrochromen-4-one.
| Compound Name | 7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 141317761 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 7-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2cc(OCCCN3CCCC3)ccc21 |
| InChI | InChI=1S/C16H21NO3/c18-15-6-11-20-16-12-13(4-5-14(15)16)19-10-3-9-17-7-1-2-8-17/h4-5,12H,1-3,6-11H2 |
| InChIKey | CXEPNBNRXMFTLD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|