C14H14N2O3 — CID 18626469
7-(2-imidazol-1-ylethoxy)-2,3-dihydrochromen-4-one (PubChem CID 18626469) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 7-(2-imidazol-1-ylethoxy)-2,3-dihydrochromen-4-one.
| Compound Name | 7-(2-imidazol-1-ylethoxy)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 18626469 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 7-(2-imidazol-1-ylethoxy)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2cc(OCCn3ccnc3)ccc21 |
| InChI | InChI=1S/C14H14N2O3/c17-13-3-7-19-14-9-11(1-2-12(13)14)18-8-6-16-5-4-15-10-16/h1-2,4-5,9-10H,3,6-8H2 |
| InChIKey | VHWBKVZQXAABDE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |