C23H20N2O4 — CID 54286466
2-(1,3-benzodioxol-5-ylmethylidene)-6-(2-imidazol-1-ylethoxy)-3,4-dihydronaphthalen-1-one (PubChem CID 54286466) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylidene)-6-(2-imidazol-1-ylethoxy)-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylidene)-6-(2-imidazol-1-ylethoxy)-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 54286466 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylidene)-6-(2-imidazol-1-ylethoxy)-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1C(=Cc2ccc3c(c2)OCO3)CCc2cc(OCCn3ccnc3)ccc21 |
| InChI | InChI=1S/C23H20N2O4/c26-23-18(11-16-1-6-21-22(12-16)29-15-28-21)3-2-17-13-19(4-5-20(17)23)27-10-9-25-8-7-24-14-25/h1,4-8,11-14H,2-3,9-10,15H2 |
| InChIKey | RULPLYKRWBSANE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|