C25H26N2O5 — CID 18626529
(2E)-6-(2-imidazol-1-ylethoxy)-2-[(2,3,4-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 18626529) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is (2E)-6-(2-imidazol-1-ylethoxy)-2-[(2,3,4-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-6-(2-imidazol-1-ylethoxy)-2-[(2,3,4-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 18626529 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (2E)-6-(2-imidazol-1-ylethoxy)-2-[(2,3,4-trimethoxyphenyl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc(/C=C2\CCc3cc(OCCn4ccnc4)ccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C25H26N2O5/c1-29-22-9-6-19(24(30-2)25(22)31-3)14-18-5-4-17-15-20(7-8-21(17)23(18)28)32-13-12-27-11-10-26-16-27/h6-11,14-16H,4-5,12-13H2,1-3H3/b18-14+ |
| InChIKey | UHIRMPFREQPUGB-NBVRZTHBSA-N |
| XLogP | 4.20 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|