C29H33NO3 — CID 67603491
(3S)-3-phenyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]-3,4-dihydro-2H-chromen-6-ol (PubChem CID 67603491) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is (3S)-3-phenyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | (3S)-3-phenyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 67603491 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (3S)-3-phenyl-4-[4-(3-piperidin-1-ylpropoxy)phenyl]-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Oc1ccc2c(c1)C(c1ccc(OCCCN3CCCCC3)cc1)[C@@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C29H33NO3/c31-24-12-15-28-26(20-24)29(27(21-33-28)22-8-3-1-4-9-22)23-10-13-25(14-11-23)32-19-7-18-30-16-5-2-6-17-30/h1,3-4,8-15,20,27,29,31H,2,5-7,16-19,21H2/t27-,29?/m1/s1 |
| InChIKey | HTDSNVFKLCFEPZ-SCBLGKRXSA-N |
| XLogP | 5.96 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|