C30H35NO2S — CID 67595481
(3R,4S)-3-phenyl-4-[4-(5-pyrrolidin-1-ylpentylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol (PubChem CID 67595481) has the molecular formula C30H35NO2S and a molecular weight of 473.68 g/mol. Its IUPAC name is (3R,4S)-3-phenyl-4-[4-(5-pyrrolidin-1-ylpentylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | (3R,4S)-3-phenyl-4-[4-(5-pyrrolidin-1-ylpentylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 67595481 |
| Molecular Formula | C30H35NO2S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (3R,4S)-3-phenyl-4-[4-(5-pyrrolidin-1-ylpentylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Oc1ccc2c(c1)[C@H](c1ccc(SCCCCCN3CCCC3)cc1)[C@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C30H35NO2S/c32-25-13-16-29-27(21-25)30(28(22-33-29)23-9-3-1-4-10-23)24-11-14-26(15-12-24)34-20-8-2-5-17-31-18-6-7-19-31/h1,3-4,9-16,21,28,30,32H,2,5-8,17-20,22H2/t28-,30-/m0/s1 |
| InChIKey | PEQCFURLVQNTON-JDXGNMNLSA-N |
| XLogP | 7.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|