C28H31NO2S — CID 67595416
(3R,4S)-3-phenyl-4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol (PubChem CID 67595416) has the molecular formula C28H31NO2S and a molecular weight of 445.63 g/mol. Its IUPAC name is (3R,4S)-3-phenyl-4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | (3R,4S)-3-phenyl-4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 67595416 |
| Molecular Formula | C28H31NO2S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (3R,4S)-3-phenyl-4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Oc1ccc2c(c1)[C@H](c1ccc(SCCCN3CCCC3)cc1)[C@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C28H31NO2S/c30-23-11-14-27-25(19-23)28(26(20-31-27)21-7-2-1-3-8-21)22-9-12-24(13-10-22)32-18-6-17-29-15-4-5-16-29/h1-3,7-14,19,26,28,30H,4-6,15-18,20H2/t26-,28-/m0/s1 |
| InChIKey | MATBNMVPVJFFNI-XCZPVHLTSA-N |
| XLogP | 6.28 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|