C33H41NO2S — CID 67597433
(3R,4S)-3-phenyl-4-[4-(8-pyrrolidin-1-yloctylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol (PubChem CID 67597433) has the molecular formula C33H41NO2S and a molecular weight of 515.76 g/mol. Its IUPAC name is (3R,4S)-3-phenyl-4-[4-(8-pyrrolidin-1-yloctylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | (3R,4S)-3-phenyl-4-[4-(8-pyrrolidin-1-yloctylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 67597433 |
| Molecular Formula | C33H41NO2S |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | (3R,4S)-3-phenyl-4-[4-(8-pyrrolidin-1-yloctylsulfanyl)phenyl]-3,4-dihydro-2H-chromen-6-ol |
| SMILES | Oc1ccc2c(c1)[C@H](c1ccc(SCCCCCCCCN3CCCC3)cc1)[C@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C33H41NO2S/c35-28-16-19-32-30(24-28)33(31(25-36-32)26-12-6-5-7-13-26)27-14-17-29(18-15-27)37-23-11-4-2-1-3-8-20-34-21-9-10-22-34/h5-7,12-19,24,31,33,35H,1-4,8-11,20-23,25H2/t31-,33-/m0/s1 |
| InChIKey | NJTDPFZMQBDWGZ-WEZIJMHWSA-N |
| XLogP | 8.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|