C12H12O — CID 11147997
(1R,5R,6R)-6-phenylbicyclo[3.1.0]hexan-2-one (PubChem CID 11147997) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is (1R,5R,6R)-6-phenylbicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,5R,6R)-6-phenylbicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 11147997 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (1R,5R,6R)-6-phenylbicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1CC[C@H]2[C@@H]1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C12H12O/c13-10-7-6-9-11(12(9)10)8-4-2-1-3-5-8/h1-5,9,11-12H,6-7H2/t9-,11-,12+/m1/s1 |
| InChIKey | MDMPNXHXNCBWCG-JLLWLGSASA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |