C15H16O — CID 134853669
(1S,6S)-7-[(E)-2-phenylethenyl]bicyclo[4.1.0]heptan-2-one (PubChem CID 134853669) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (1S,6S)-7-[(E)-2-phenylethenyl]bicyclo[4.1.0]heptan-2-one.
| Compound Name | (1S,6S)-7-[(E)-2-phenylethenyl]bicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 134853669 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (1S,6S)-7-[(E)-2-phenylethenyl]bicyclo[4.1.0]heptan-2-one |
| SMILES | O=C1CCC[C@H]2C(/C=C/c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C15H16O/c16-14-8-4-7-12-13(15(12)14)10-9-11-5-2-1-3-6-11/h1-3,5-6,9-10,12-13,15H,4,7-8H2/b10-9+/t12-,13?,15-/m0/s1 |
| InChIKey | YQWRDMHYTUQIND-CIFAOWNTSA-N |
| XLogP | 3.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |