C15H18N2O2 — CID 102414577
(4R,4aR,8aR)-4-[(E)-2-phenylethenyl]-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one (PubChem CID 102414577) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (4R,4aR,8aR)-4-[(E)-2-phenylethenyl]-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one.
| Compound Name | (4R,4aR,8aR)-4-[(E)-2-phenylethenyl]-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 102414577 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (4R,4aR,8aR)-4-[(E)-2-phenylethenyl]-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one |
| SMILES | O=C1N[C@@H]2OCCC[C@@H]2[C@@H](/C=C/c2ccccc2)N1 |
| InChI | InChI=1S/C15H18N2O2/c18-15-16-13(9-8-11-5-2-1-3-6-11)12-7-4-10-19-14(12)17-15/h1-3,5-6,8-9,12-14H,4,7,10H2,(H2,16,17,18)/b9-8+/t12-,13-,14-/m1/s1 |
| InChIKey | UJMDGZMPGFLPRE-FGBBUQKBSA-N |
| XLogP | 2.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |