C11H13NO3S — CID 102230223
4-[(E)-2-phenylethenyl]oxathiazinane 2,2-dioxide (PubChem CID 102230223) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 4-[(E)-2-phenylethenyl]oxathiazinane 2,2-dioxide.
| Compound Name | 4-[(E)-2-phenylethenyl]oxathiazinane 2,2-dioxide |
|---|---|
| PubChem CID | 102230223 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 4-[(E)-2-phenylethenyl]oxathiazinane 2,2-dioxide |
| SMILES | O=S1(=O)NC(/C=C/c2ccccc2)CCO1 |
| InChI | InChI=1S/C11H13NO3S/c13-16(14)12-11(8-9-15-16)7-6-10-4-2-1-3-5-10/h1-7,11-12H,8-9H2/b7-6+ |
| InChIKey | HTUIBWZTZBSSLN-VOTSOKGWSA-N |
| XLogP | 1.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |