C13H14O — CID 85470685
(4R)-4-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyran (PubChem CID 85470685) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is (4R)-4-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyran.
| Compound Name | (4R)-4-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 85470685 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (4R)-4-[(E)-2-phenylethenyl]-3,4-dihydro-2H-pyran |
| SMILES | C1=C[C@@H](/C=C/c2ccccc2)CCO1 |
| InChI | InChI=1S/C13H14O/c1-2-4-12(5-3-1)6-7-13-8-10-14-11-9-13/h1-8,10,13H,9,11H2/b7-6+/t13-/m1/s1 |
| InChIKey | YZHLCMXWVLWOSR-KTRBRXNASA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |