C22H22O2 — CID 170021549
(3S,3aR,6R,6aR)-3,6-bis(2-phenylethenyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 170021549) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3,6-bis(2-phenylethenyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aR)-3,6-bis(2-phenylethenyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 170021549 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3S,3aR,6R,6aR)-3,6-bis(2-phenylethenyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C(=C[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22O2/c1-3-7-17(8-4-1)11-13-19-15-23-22-20(16-24-21(19)22)14-12-18-9-5-2-6-10-18/h1-14,19-22H,15-16H2/t19-,20+,21-,22-/m1/s1 |
| InChIKey | AAMBOZQILHRTOM-CIAFKFPVSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |