C28H30O2 — CID 170021539
(3S,3aR,6R,6aR)-3,6-bis[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 170021539) has the molecular formula C28H30O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3,6-bis[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aR)-3,6-bis[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 170021539 |
| Molecular Formula | C28H30O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (3S,3aR,6R,6aR)-3,6-bis[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C=C(C)c1ccc(C=C[C@@H]2CO[C@H]3[C@@H]2OC[C@@H]3C=Cc2ccc(C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C28H30O2/c1-19(2)23-11-5-21(6-12-23)9-15-25-17-29-28-26(18-30-27(25)28)16-10-22-7-13-24(14-8-22)20(3)4/h5-16,25-28H,1,3,17-18H2,2,4H3/t25-,26+,27-,28-/m1/s1 |
| InChIKey | CHTQMNUTDVLRMN-JUDWXZBOSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |