C32H34O7 — CID 158579684
2-[4-[(E)-3-[[(3R,3aR,6R,6aS)-3-[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-oxoprop-1-enyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 158579684) has the molecular formula C32H34O7 and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-[4-[(E)-3-[[(3R,3aR,6R,6aS)-3-[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-oxoprop-1-enyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[(E)-3-[[(3R,3aR,6R,6aS)-3-[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-oxoprop-1-enyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158579684 |
| Molecular Formula | C32H34O7 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 2-[4-[(E)-3-[[(3R,3aR,6R,6aS)-3-[2-(4-prop-1-en-2-ylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-oxoprop-1-enyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(/C=C/C(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3C=Cc2ccc(C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C32H34O7/c1-21(2)25-11-5-23(6-12-25)7-13-26-19-37-31-28(20-38-30(26)31)39-29(33)16-10-24-8-14-27(15-9-24)35-17-18-36-32(34)22(3)4/h5-16,26,28,30-31H,1,3,17-20H2,2,4H3/b13-7?,16-10+/t26-,28-,30-,31-/m1/s1 |
| InChIKey | PTERGJZQHWUPPS-HJUNDAMASA-N |
| XLogP | 5.27 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|