C26H26O6 — CID 59076001
[(3R,3aR,6R,6aR)-6-[3-(4-methylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-(4-methylphenyl)prop-2-enoate (PubChem CID 59076001) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-6-[3-(4-methylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(3R,3aR,6R,6aR)-6-[3-(4-methylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 59076001 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [(3R,3aR,6R,6aR)-6-[3-(4-methylphenyl)prop-2-enoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(C=CC(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3OC(=O)C=Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H26O6/c1-17-3-7-19(8-4-17)11-13-23(27)31-21-15-29-26-22(16-30-25(21)26)32-24(28)14-12-20-9-5-18(2)6-10-20/h3-14,21-22,25-26H,15-16H2,1-2H3/t21-,22-,25-,26-/m1/s1 |
| InChIKey | NXSJUSVAIFIHSG-SAZLYLDSSA-N |
| XLogP | 3.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|