C28H28O6 — CID 59915667
[(3R,3aR,6S,6aS)-6-[(E)-3-(4-ethenylphenyl)prop-2-enyl]peroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (Z)-3-(4-ethenylphenyl)prop-2-enoate (PubChem CID 59915667) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-6-[(E)-3-(4-ethenylphenyl)prop-2-enyl]peroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (Z)-3-(4-ethenylphenyl)prop-2-enoate.
| Compound Name | [(3R,3aR,6S,6aS)-6-[(E)-3-(4-ethenylphenyl)prop-2-enyl]peroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (Z)-3-(4-ethenylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 59915667 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [(3R,3aR,6S,6aS)-6-[(E)-3-(4-ethenylphenyl)prop-2-enyl]peroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (Z)-3-(4-ethenylphenyl)prop-2-enoate |
| SMILES | C=Cc1ccc(/C=C\C(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@@H]3OOC/C=C/c2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C28H28O6/c1-3-20-7-11-22(12-8-20)6-5-17-32-34-25-19-31-27-24(18-30-28(25)27)33-26(29)16-15-23-13-9-21(4-2)10-14-23/h3-16,24-25,27-28H,1-2,17-19H2/b6-5+,16-15-/t24-,25+,27-,28-/m1/s1 |
| InChIKey | AXSGSLRFGGZTGY-MRUNEDSRSA-N |
| XLogP | 4.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|