C26H30O6P2 — CID 58980359
[(3R,3aS,6S,6aS)-3-[(E)-3-[4-(phosphanylmethyl)phenyl]prop-2-enyl]peroxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-6-yl] (Z)-3-[4-(phosphanylmethyl)phenyl]prop-2-enoate (PubChem CID 58980359) has the molecular formula C26H30O6P2 and a molecular weight of 500.47 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-3-[(E)-3-[4-(phosphanylmethyl)phenyl]prop-2-enyl]peroxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-6-yl] (Z)-3-[4-(phosphanylmethyl)phenyl]prop-2-enoate.
| Compound Name | [(3R,3aS,6S,6aS)-3-[(E)-3-[4-(phosphanylmethyl)phenyl]prop-2-enyl]peroxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-6-yl] (Z)-3-[4-(phosphanylmethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58980359 |
| Molecular Formula | C26H30O6P2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | [(3R,3aS,6S,6aS)-3-[(E)-3-[4-(phosphanylmethyl)phenyl]prop-2-enyl]peroxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-6-yl] (Z)-3-[4-(phosphanylmethyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C\c1ccc(CP)cc1)O[C@@H]1OC[C@H]2[C@@H]1OC[C@@H]2OOC/C=C/c1ccc(CP)cc1 |
| InChI | InChI=1S/C26H30O6P2/c27-24(12-11-19-5-9-21(17-34)10-6-19)31-26-25-22(14-29-26)23(15-28-25)32-30-13-1-2-18-3-7-20(16-33)8-4-18/h1-12,22-23,25-26H,13-17,33-34H2/b2-1+,12-11-/t22-,23+,25+,26+/m1/s1 |
| InChIKey | HFEQBDRTVXUCAM-GVHHBJLRSA-N |
| XLogP | 4.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|