C26H28O6 — CID 91016261
(4-methylphenyl)methyl (2E)-2-[(3S,3aS,6aR)-3-[(E)-3-(4-methylphenyl)prop-2-enyl]peroxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]acetate (PubChem CID 91016261) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2E)-2-[(3S,3aS,6aR)-3-[(E)-3-(4-methylphenyl)prop-2-enyl]peroxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]acetate.
| Compound Name | (4-methylphenyl)methyl (2E)-2-[(3S,3aS,6aR)-3-[(E)-3-(4-methylphenyl)prop-2-enyl]peroxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]acetate |
|---|---|
| PubChem CID | 91016261 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (4-methylphenyl)methyl (2E)-2-[(3S,3aS,6aR)-3-[(E)-3-(4-methylphenyl)prop-2-enyl]peroxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-ylidene]acetate |
| SMILES | Cc1ccc(/C=C/COO[C@H]2CO[C@@H]3/C(=C/C(=O)OCc4ccc(C)cc4)CO[C@H]23)cc1 |
| InChI | InChI=1S/C26H28O6/c1-18-5-9-20(10-6-18)4-3-13-31-32-23-17-30-25-22(16-29-26(23)25)14-24(27)28-15-21-11-7-19(2)8-12-21/h3-12,14,23,25-26H,13,15-17H2,1-2H3/b4-3+,22-14+/t23-,25+,26+/m0/s1 |
| InChIKey | KWATXIMFJULUFG-UEEJWDJNSA-N |
| XLogP | 4.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|